C12H16N4O4 — CID 104824645
2-amino-6-[[bis(2-amino-2-oxoethyl)amino]methyl]benzoic acid (PubChem CID 104824645) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2-amino-6-[[bis(2-amino-2-oxoethyl)amino]methyl]benzoic acid.
| Compound Name | 2-amino-6-[[bis(2-amino-2-oxoethyl)amino]methyl]benzoic acid |
|---|---|
| PubChem CID | 104824645 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2-amino-6-[[bis(2-amino-2-oxoethyl)amino]methyl]benzoic acid |
| SMILES | NC(=O)CN(CC(N)=O)Cc1cccc(N)c1C(=O)O |
| InChI | InChI=1S/C12H16N4O4/c13-8-3-1-2-7(11(8)12(19)20)4-16(5-9(14)17)6-10(15)18/h1-3H,4-6,13H2,(H2,14,17)(H2,15,18)(H,19,20) |
| InChIKey | RPWAXMOOIXMBFE-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 152.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|