C12H17FN4O2 — CID 107113368
2-[[3-(aminomethyl)-2-fluorophenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide (PubChem CID 107113368) has the molecular formula C12H17FN4O2 and a molecular weight of 268.29 g/mol. Its IUPAC name is 2-[[3-(aminomethyl)-2-fluorophenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide.
| Compound Name | 2-[[3-(aminomethyl)-2-fluorophenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide |
|---|---|
| PubChem CID | 107113368 |
| Molecular Formula | C12H17FN4O2 |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-[[3-(aminomethyl)-2-fluorophenyl]methyl-(2-amino-2-oxoethyl)amino]acetamide |
| SMILES | NCc1cccc(CN(CC(N)=O)CC(N)=O)c1F |
| InChI | InChI=1S/C12H17FN4O2/c13-12-8(4-14)2-1-3-9(12)5-17(6-10(15)18)7-11(16)19/h1-3H,4-7,14H2,(H2,15,18)(H2,16,19) |
| InChIKey | KAIQVEAIFSDCBG-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |