C11H14FN3OS — CID 107115327
2-[(3-carbamothioyl-2-fluorophenyl)methyl-methylamino]acetamide (PubChem CID 107115327) has the molecular formula C11H14FN3OS and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[(3-carbamothioyl-2-fluorophenyl)methyl-methylamino]acetamide.
| Compound Name | 2-[(3-carbamothioyl-2-fluorophenyl)methyl-methylamino]acetamide |
|---|---|
| PubChem CID | 107115327 |
| Molecular Formula | C11H14FN3OS |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-[(3-carbamothioyl-2-fluorophenyl)methyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)Cc1cccc(C(N)=S)c1F |
| InChI | InChI=1S/C11H14FN3OS/c1-15(6-9(13)16)5-7-3-2-4-8(10(7)12)11(14)17/h2-4H,5-6H2,1H3,(H2,13,16)(H2,14,17) |
| InChIKey | PNLDSNLKFHWDRX-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|