C12H16N4O3 — CID 55157593
N,N-bis(2-amino-2-oxoethyl)-2-(2-aminophenyl)acetamide (PubChem CID 55157593) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-2-(2-aminophenyl)acetamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-2-(2-aminophenyl)acetamide |
|---|---|
| PubChem CID | 55157593 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-2-(2-aminophenyl)acetamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)Cc1ccccc1N |
| InChI | InChI=1S/C12H16N4O3/c13-9-4-2-1-3-8(9)5-12(19)16(6-10(14)17)7-11(15)18/h1-4H,5-7,13H2,(H2,14,17)(H2,15,18) |
| InChIKey | JOGMDDQZSZDXAO-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 132.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|