About 2-(2-aminophenyl)acetyl bromide;hydrobromide
2-(2-aminophenyl)acetyl bromide;hydrobromide (PubChem CID 71437218) has the molecular formula C8H9Br2NO
and a molecular weight of 294.97 g/mol. Its IUPAC name is 2-(2-aminophenyl)acetyl bromide;hydrobromide.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)acetyl bromide;hydrobromide |
| PubChem CID | 71437218 |
| Molecular Formula | C8H9Br2NO |
| Molecular Weight | 294.97 g/mol |
| Exact Mass | 292.91 |
| IUPAC Name | 2-(2-aminophenyl)acetyl bromide;hydrobromide |
| SMILES | Br.Nc1ccccc1CC(=O)Br |
| InChI | InChI=1S/C8H8BrNO.BrH/c9-8(11)5-6-3-1-2-4-7(6)10;/h1-4H,5,10H2;1H |
| InChIKey | SPANSXCOKJJGDV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.97 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)acetyl bromide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)acetyl bromide;hydrobromide?
The IUPAC name of 2-(2-aminophenyl)acetyl bromide;hydrobromide (CID 71437218) is 2-(2-aminophenyl)acetyl bromide;hydrobromide.
What is the SMILES notation for 2-(2-aminophenyl)acetyl bromide;hydrobromide?
The canonical SMILES for 2-(2-aminophenyl)acetyl bromide;hydrobromide is Br.Nc1ccccc1CC(=O)Br.
What is the InChIKey of 2-(2-aminophenyl)acetyl bromide;hydrobromide?
The InChIKey is SPANSXCOKJJGDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrNO.BrH/c9-8(11)5-6-3-1-2-4-7(6)10;/h1-4H,5,10H2;1H.
What are the key properties of 2-(2-aminophenyl)acetyl bromide;hydrobromide?
2-(2-aminophenyl)acetyl bromide;hydrobromide has a molecular weight of 294.97 g/mol, XLogP of 2.31, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)acetyl bromide;hydrobromide is sourced from PubChem (CID 71437218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).