About 2-ethylaniline;propane
2-ethylaniline;propane (PubChem CID 143529464) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is 2-ethylaniline;propane.
Molecular Properties
| Compound Name | 2-ethylaniline;propane |
| PubChem CID | 143529464 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | 2-ethylaniline;propane |
| SMILES | CCC.CCc1ccccc1N |
| InChI | InChI=1S/C8H11N.C3H8/c1-2-7-5-3-4-6-8(7)9;1-3-2/h3-6H,2,9H2,1H3;3H2,1-2H3 |
| InChIKey | PYGPMMIEOBBJNL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylaniline;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylaniline;propane?
The IUPAC name of 2-ethylaniline;propane (CID 143529464) is 2-ethylaniline;propane.
What is the SMILES notation for 2-ethylaniline;propane?
The canonical SMILES for 2-ethylaniline;propane is CCC.CCc1ccccc1N.
What is the InChIKey of 2-ethylaniline;propane?
The InChIKey is PYGPMMIEOBBJNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C3H8/c1-2-7-5-3-4-6-8(7)9;1-3-2/h3-6H,2,9H2,1H3;3H2,1-2H3.
What are the key properties of 2-ethylaniline;propane?
2-ethylaniline;propane has a molecular weight of 165.28 g/mol, XLogP of 3.25, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylaniline;propane is sourced from PubChem (CID 143529464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).