C11H17NO — CID 157370947
1,2-diethylbenzene;formamide (PubChem CID 157370947) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1,2-diethylbenzene;formamide.
| Compound Name | 1,2-diethylbenzene;formamide |
|---|---|
| PubChem CID | 157370947 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1,2-diethylbenzene;formamide |
| SMILES | CCc1ccccc1CC.NC=O |
| InChI | InChI=1S/C10H14.CH3NO/c1-3-9-7-5-6-8-10(9)4-2;2-1-3/h5-8H,3-4H2,1-2H3;1H,(H2,2,3) |
| InChIKey | BJTHTQFKOCKPCJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|