About 1,2-diethylbenzene;silyloxysilane
1,2-diethylbenzene;silyloxysilane (PubChem CID 158803052) has the molecular formula C10H20OSi2
and a molecular weight of 212.44 g/mol. Its IUPAC name is 1,2-diethylbenzene;silyloxysilane.
Molecular Properties
| Compound Name | 1,2-diethylbenzene;silyloxysilane |
| PubChem CID | 158803052 |
| Molecular Formula | C10H20OSi2 |
| Molecular Weight | 212.44 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1,2-diethylbenzene;silyloxysilane |
| SMILES | CCc1ccccc1CC.[SiH3]O[SiH3] |
| InChI | InChI=1S/C10H14.H6OSi2/c1-3-9-7-5-6-8-10(9)4-2;2-1-3/h5-8H,3-4H2,1-2H3;2-3H3 |
| InChIKey | ITSODHMKNAYEPH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1,2-diethylbenzene;silyloxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-diethylbenzene;silyloxysilane?
The IUPAC name of 1,2-diethylbenzene;silyloxysilane (CID 158803052) is 1,2-diethylbenzene;silyloxysilane.
What is the SMILES notation for 1,2-diethylbenzene;silyloxysilane?
The canonical SMILES for 1,2-diethylbenzene;silyloxysilane is CCc1ccccc1CC.[SiH3]O[SiH3].
What is the InChIKey of 1,2-diethylbenzene;silyloxysilane?
The InChIKey is ITSODHMKNAYEPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14.H6OSi2/c1-3-9-7-5-6-8-10(9)4-2;2-1-3/h5-8H,3-4H2,1-2H3;2-3H3.
What are the key properties of 1,2-diethylbenzene;silyloxysilane?
1,2-diethylbenzene;silyloxysilane has a molecular weight of 212.44 g/mol, XLogP of 0.38, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-diethylbenzene;silyloxysilane is sourced from PubChem (CID 158803052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).