C10H20OSi2 — CID 158803052
1,2-diethylbenzene;silyloxysilane (PubChem CID 158803052) has the molecular formula C10H20OSi2 and a molecular weight of 212.44 g/mol. Its IUPAC name is 1,2-diethylbenzene;silyloxysilane.
| Compound Name | 1,2-diethylbenzene;silyloxysilane |
|---|---|
| PubChem CID | 158803052 |
| Molecular Formula | C10H20OSi2 |
| Molecular Weight | 212.44 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1,2-diethylbenzene;silyloxysilane |
| SMILES | CCc1ccccc1CC.[SiH3]O[SiH3] |
| InChI | InChI=1S/C10H14.H6OSi2/c1-3-9-7-5-6-8-10(9)4-2;2-1-3/h5-8H,3-4H2,1-2H3;2-3H3 |
| InChIKey | ITSODHMKNAYEPH-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.44 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|