About (2-ethylphenyl)methyl nitrite
(2-ethylphenyl)methyl nitrite (PubChem CID 154123922) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is (2-ethylphenyl)methyl nitrite.
Molecular Properties
| Compound Name | (2-ethylphenyl)methyl nitrite |
| PubChem CID | 154123922 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (2-ethylphenyl)methyl nitrite |
| SMILES | CCc1ccccc1CON=O |
| InChI | InChI=1S/C9H11NO2/c1-2-8-5-3-4-6-9(8)7-12-10-11/h3-6H,2,7H2,1H3 |
| InChIKey | UUFVLCFBYUYLMD-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylphenyl)methyl nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylphenyl)methyl nitrite?
The IUPAC name of (2-ethylphenyl)methyl nitrite (CID 154123922) is (2-ethylphenyl)methyl nitrite.
What is the SMILES notation for (2-ethylphenyl)methyl nitrite?
The canonical SMILES for (2-ethylphenyl)methyl nitrite is CCc1ccccc1CON=O.
What is the InChIKey of (2-ethylphenyl)methyl nitrite?
The InChIKey is UUFVLCFBYUYLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-2-8-5-3-4-6-9(8)7-12-10-11/h3-6H,2,7H2,1H3.
What are the key properties of (2-ethylphenyl)methyl nitrite?
(2-ethylphenyl)methyl nitrite has a molecular weight of 165.19 g/mol, XLogP of 2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylphenyl)methyl nitrite is sourced from PubChem (CID 154123922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).