About 2-(aminomethyl)aniline;hydrochloride
2-(aminomethyl)aniline;hydrochloride (PubChem CID 69170371) has the molecular formula C7H11ClN2
and a molecular weight of 158.63 g/mol. Its IUPAC name is 2-(aminomethyl)aniline;hydrochloride.
Molecular Properties
| Compound Name | 2-(aminomethyl)aniline;hydrochloride |
| PubChem CID | 69170371 |
| Molecular Formula | C7H11ClN2 |
| Molecular Weight | 158.63 g/mol |
| Exact Mass | 158.06 |
| IUPAC Name | 2-(aminomethyl)aniline;hydrochloride |
| SMILES | Cl.NCc1ccccc1N |
| InChI | InChI=1S/C7H10N2.ClH/c8-5-6-3-1-2-4-7(6)9;/h1-4H,5,8-9H2;1H |
| InChIKey | YILCUDPFTCXVID-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.63 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)aniline;hydrochloride?
The IUPAC name of 2-(aminomethyl)aniline;hydrochloride (CID 69170371) is 2-(aminomethyl)aniline;hydrochloride.
What is the SMILES notation for 2-(aminomethyl)aniline;hydrochloride?
The canonical SMILES for 2-(aminomethyl)aniline;hydrochloride is Cl.NCc1ccccc1N.
What is the InChIKey of 2-(aminomethyl)aniline;hydrochloride?
The InChIKey is YILCUDPFTCXVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.ClH/c8-5-6-3-1-2-4-7(6)9;/h1-4H,5,8-9H2;1H.
What are the key properties of 2-(aminomethyl)aniline;hydrochloride?
2-(aminomethyl)aniline;hydrochloride has a molecular weight of 158.63 g/mol, XLogP of 1.15, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)aniline;hydrochloride is sourced from PubChem (CID 69170371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).