C8H16N4 — CID 20510389
benzene-1,2-diamine;ethane-1,2-diamine (PubChem CID 20510389) has the molecular formula C8H16N4 and a molecular weight of 168.24 g/mol. Its IUPAC name is benzene-1,2-diamine;ethane-1,2-diamine.
| Compound Name | benzene-1,2-diamine;ethane-1,2-diamine |
|---|---|
| PubChem CID | 20510389 |
| Molecular Formula | C8H16N4 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.14 |
| IUPAC Name | benzene-1,2-diamine;ethane-1,2-diamine |
| SMILES | NCCN.Nc1ccccc1N |
| InChI | InChI=1S/C6H8N2.C2H8N2/c7-5-3-1-2-4-6(5)8;3-1-2-4/h1-4H,7-8H2;1-4H2 |
| InChIKey | JCAWSUJCJVBDBW-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|