About 2-aminobenzaldehyde;ethane-1,2-diamine;nickel
2-aminobenzaldehyde;ethane-1,2-diamine;nickel (PubChem CID 87671040) has the molecular formula C9H15N3NiO
and a molecular weight of 239.93 g/mol. Its IUPAC name is 2-aminobenzaldehyde;ethane-1,2-diamine;nickel.
Molecular Properties
| Compound Name | 2-aminobenzaldehyde;ethane-1,2-diamine;nickel |
| PubChem CID | 87671040 |
| Molecular Formula | C9H15N3NiO |
| Molecular Weight | 239.93 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-aminobenzaldehyde;ethane-1,2-diamine;nickel |
| SMILES | NCCN.Nc1ccccc1C=O.[Ni] |
| InChI | InChI=1S/C7H7NO.C2H8N2.Ni/c8-7-4-2-1-3-6(7)5-9;3-1-2-4;/h1-5H,8H2;1-4H2; |
| InChIKey | CEPWJDJHJXIRNA-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 95.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.93 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzaldehyde;ethane-1,2-diamine;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzaldehyde;ethane-1,2-diamine;nickel?
The IUPAC name of 2-aminobenzaldehyde;ethane-1,2-diamine;nickel (CID 87671040) is 2-aminobenzaldehyde;ethane-1,2-diamine;nickel.
What is the SMILES notation for 2-aminobenzaldehyde;ethane-1,2-diamine;nickel?
The canonical SMILES for 2-aminobenzaldehyde;ethane-1,2-diamine;nickel is NCCN.Nc1ccccc1C=O.[Ni].
What is the InChIKey of 2-aminobenzaldehyde;ethane-1,2-diamine;nickel?
The InChIKey is CEPWJDJHJXIRNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO.C2H8N2.Ni/c8-7-4-2-1-3-6(7)5-9;3-1-2-4;/h1-5H,8H2;1-4H2;.
What are the key properties of 2-aminobenzaldehyde;ethane-1,2-diamine;nickel?
2-aminobenzaldehyde;ethane-1,2-diamine;nickel has a molecular weight of 239.93 g/mol, XLogP of -0.02, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzaldehyde;ethane-1,2-diamine;nickel is sourced from PubChem (CID 87671040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).