C13H14N2O2 — CID 22463498
benzene-1,2-diamine;2-hydroxybenzaldehyde (PubChem CID 22463498) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is benzene-1,2-diamine;2-hydroxybenzaldehyde.
| Compound Name | benzene-1,2-diamine;2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 22463498 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | benzene-1,2-diamine;2-hydroxybenzaldehyde |
| SMILES | Nc1ccccc1N.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H6O2.C6H8N2/c8-5-6-3-1-2-4-7(6)9;7-5-3-1-2-4-6(5)8/h1-5,9H;1-4H,7-8H2 |
| InChIKey | TUVOSPHGHDSGCI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|