About aniline;2-hydroxybenzaldehyde
aniline;2-hydroxybenzaldehyde (PubChem CID 159847329) has the molecular formula C13H13NO2
and a molecular weight of 215.25 g/mol. Its IUPAC name is aniline;2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | aniline;2-hydroxybenzaldehyde |
| PubChem CID | 159847329 |
| Molecular Formula | C13H13NO2 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | aniline;2-hydroxybenzaldehyde |
| SMILES | Nc1ccccc1.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H6O2.C6H7N/c8-5-6-3-1-2-4-7(6)9;7-6-4-2-1-3-5-6/h1-5,9H;1-5H,7H2 |
| InChIKey | NPMALLPLXOKHGU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;2-hydroxybenzaldehyde?
The IUPAC name of aniline;2-hydroxybenzaldehyde (CID 159847329) is aniline;2-hydroxybenzaldehyde.
What is the SMILES notation for aniline;2-hydroxybenzaldehyde?
The canonical SMILES for aniline;2-hydroxybenzaldehyde is Nc1ccccc1.O=Cc1ccccc1O.
What is the InChIKey of aniline;2-hydroxybenzaldehyde?
The InChIKey is NPMALLPLXOKHGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H7N/c8-5-6-3-1-2-4-7(6)9;7-6-4-2-1-3-5-6/h1-5,9H;1-5H,7H2.
What are the key properties of aniline;2-hydroxybenzaldehyde?
aniline;2-hydroxybenzaldehyde has a molecular weight of 215.25 g/mol, XLogP of 2.47, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;2-hydroxybenzaldehyde is sourced from PubChem (CID 159847329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).