C19H16O6 — CID 175399417
2-hydroxybenzaldehyde;5-phenylbenzene-1,2,3,4-tetrol (PubChem CID 175399417) has the molecular formula C19H16O6 and a molecular weight of 340.33 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;5-phenylbenzene-1,2,3,4-tetrol.
| Compound Name | 2-hydroxybenzaldehyde;5-phenylbenzene-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 175399417 |
| Molecular Formula | C19H16O6 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | 2-hydroxybenzaldehyde;5-phenylbenzene-1,2,3,4-tetrol |
| SMILES | O=Cc1ccccc1O.Oc1cc(-c2ccccc2)c(O)c(O)c1O |
| InChI | InChI=1S/C12H10O4.C7H6O2/c13-9-6-8(7-4-2-1-3-5-7)10(14)12(16)11(9)15;8-5-6-3-1-2-4-7(6)9/h1-6,13-16H;1-5,9H |
| InChIKey | WOCYAWOHLNFQPY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|