About sodium;hydride;2-hydroxybenzaldehyde
sodium;hydride;2-hydroxybenzaldehyde (PubChem CID 173406661) has the molecular formula C7H7NaO2
and a molecular weight of 146.12 g/mol. Its IUPAC name is sodium;hydride;2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | sodium;hydride;2-hydroxybenzaldehyde |
| PubChem CID | 173406661 |
| Molecular Formula | C7H7NaO2 |
| Molecular Weight | 146.12 g/mol |
| Exact Mass | 146.03 |
| IUPAC Name | sodium;hydride;2-hydroxybenzaldehyde |
| SMILES | O=Cc1ccccc1O.[H-].[Na+] |
| InChI | InChI=1S/C7H6O2.Na.H/c8-5-6-3-1-2-4-7(6)9;;/h1-5,9H;;/q;+1;-1 |
| InChIKey | DYRBPQSDJUYMDU-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.12 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;2-hydroxybenzaldehyde?
The IUPAC name of sodium;hydride;2-hydroxybenzaldehyde (CID 173406661) is sodium;hydride;2-hydroxybenzaldehyde.
What is the SMILES notation for sodium;hydride;2-hydroxybenzaldehyde?
The canonical SMILES for sodium;hydride;2-hydroxybenzaldehyde is O=Cc1ccccc1O.[H-].[Na+].
What is the InChIKey of sodium;hydride;2-hydroxybenzaldehyde?
The InChIKey is DYRBPQSDJUYMDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.Na.H/c8-5-6-3-1-2-4-7(6)9;;/h1-5,9H;;/q;+1;-1.
What are the key properties of sodium;hydride;2-hydroxybenzaldehyde?
sodium;hydride;2-hydroxybenzaldehyde has a molecular weight of 146.12 g/mol, XLogP of -1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;2-hydroxybenzaldehyde is sourced from PubChem (CID 173406661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).