About disodium;2-hydroxybenzaldehyde;sulfite
disodium;2-hydroxybenzaldehyde;sulfite (PubChem CID 21115552) has the molecular formula C7H6Na2O5S
and a molecular weight of 248.17 g/mol. Its IUPAC name is disodium;2-hydroxybenzaldehyde;sulfite.
Molecular Properties
| Compound Name | disodium;2-hydroxybenzaldehyde;sulfite |
| PubChem CID | 21115552 |
| Molecular Formula | C7H6Na2O5S |
| Molecular Weight | 248.17 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | disodium;2-hydroxybenzaldehyde;sulfite |
| SMILES | O=Cc1ccccc1O.O=S([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C7H6O2.2Na.H2O3S/c8-5-6-3-1-2-4-7(6)9;;;1-4(2)3/h1-5,9H;;;(H2,1,2,3)/q;2*+1;/p-2 |
| InChIKey | FKTVARQCHFFZEC-UHFFFAOYSA-L |
| XLogP | -5.79 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.17 |
| LogP ≤ 5 | -5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-hydroxybenzaldehyde;sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-hydroxybenzaldehyde;sulfite?
The IUPAC name of disodium;2-hydroxybenzaldehyde;sulfite (CID 21115552) is disodium;2-hydroxybenzaldehyde;sulfite.
What is the SMILES notation for disodium;2-hydroxybenzaldehyde;sulfite?
The canonical SMILES for disodium;2-hydroxybenzaldehyde;sulfite is O=Cc1ccccc1O.O=S([O-])[O-].[Na+].[Na+].
What is the InChIKey of disodium;2-hydroxybenzaldehyde;sulfite?
The InChIKey is FKTVARQCHFFZEC-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O2.2Na.H2O3S/c8-5-6-3-1-2-4-7(6)9;;;1-4(2)3/h1-5,9H;;;(H2,1,2,3)/q;2*+1;/p-2.
What are the key properties of disodium;2-hydroxybenzaldehyde;sulfite?
disodium;2-hydroxybenzaldehyde;sulfite has a molecular weight of 248.17 g/mol, XLogP of -5.79, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-hydroxybenzaldehyde;sulfite is sourced from PubChem (CID 21115552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).