About 2-hydroxybenzaldehyde;methanamine
2-hydroxybenzaldehyde;methanamine (PubChem CID 174602056) has the molecular formula C10H21N3O2
and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;methanamine.
Molecular Properties
| Compound Name | 2-hydroxybenzaldehyde;methanamine |
| PubChem CID | 174602056 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-hydroxybenzaldehyde;methanamine |
| SMILES | CN.CN.CN.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H6O2.3CH5N/c8-5-6-3-1-2-4-7(6)9;3*1-2/h1-5,9H;3*2H2,1H3 |
| InChIKey | AOFOKNGAEGYZIR-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzaldehyde;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzaldehyde;methanamine?
The IUPAC name of 2-hydroxybenzaldehyde;methanamine (CID 174602056) is 2-hydroxybenzaldehyde;methanamine.
What is the SMILES notation for 2-hydroxybenzaldehyde;methanamine?
The canonical SMILES for 2-hydroxybenzaldehyde;methanamine is CN.CN.CN.O=Cc1ccccc1O.
What is the InChIKey of 2-hydroxybenzaldehyde;methanamine?
The InChIKey is AOFOKNGAEGYZIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.3CH5N/c8-5-6-3-1-2-4-7(6)9;3*1-2/h1-5,9H;3*2H2,1H3.
What are the key properties of 2-hydroxybenzaldehyde;methanamine?
2-hydroxybenzaldehyde;methanamine has a molecular weight of 215.30 g/mol, XLogP of -0.07, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzaldehyde;methanamine is sourced from PubChem (CID 174602056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).