About ethene;2-hydroxybenzaldehyde
ethene;2-hydroxybenzaldehyde (PubChem CID 23043417) has the molecular formula C9H10O2
and a molecular weight of 150.18 g/mol. Its IUPAC name is ethene;2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | ethene;2-hydroxybenzaldehyde |
| PubChem CID | 23043417 |
| Molecular Formula | C9H10O2 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | ethene;2-hydroxybenzaldehyde |
| SMILES | C=C.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H6O2.C2H4/c8-5-6-3-1-2-4-7(6)9;1-2/h1-5,9H;1-2H2 |
| InChIKey | SXFAOOJYILDECN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-hydroxybenzaldehyde?
The IUPAC name of ethene;2-hydroxybenzaldehyde (CID 23043417) is ethene;2-hydroxybenzaldehyde.
What is the SMILES notation for ethene;2-hydroxybenzaldehyde?
The canonical SMILES for ethene;2-hydroxybenzaldehyde is C=C.O=Cc1ccccc1O.
What is the InChIKey of ethene;2-hydroxybenzaldehyde?
The InChIKey is SXFAOOJYILDECN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H4/c8-5-6-3-1-2-4-7(6)9;1-2/h1-5,9H;1-2H2.
What are the key properties of ethene;2-hydroxybenzaldehyde?
ethene;2-hydroxybenzaldehyde has a molecular weight of 150.18 g/mol, XLogP of 2.01, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-hydroxybenzaldehyde is sourced from PubChem (CID 23043417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).