About 2-hydroxybenzaldehyde;nickel(2+)
2-hydroxybenzaldehyde;nickel(2+) (PubChem CID 18320961) has the molecular formula C7H6NiO2+2
and a molecular weight of 180.82 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;nickel(2+).
Molecular Properties
| Compound Name | 2-hydroxybenzaldehyde;nickel(2+) |
| PubChem CID | 18320961 |
| Molecular Formula | C7H6NiO2+2 |
| Molecular Weight | 180.82 g/mol |
| Exact Mass | 179.97 |
| IUPAC Name | 2-hydroxybenzaldehyde;nickel(2+) |
| SMILES | O=Cc1ccccc1O.[Ni+2] |
| InChI | InChI=1S/C7H6O2.Ni/c8-5-6-3-1-2-4-7(6)9;/h1-5,9H;/q;+2 |
| InChIKey | LWYLEPCHODNCFU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.82 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzaldehyde;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzaldehyde;nickel(2+)?
The IUPAC name of 2-hydroxybenzaldehyde;nickel(2+) (CID 18320961) is 2-hydroxybenzaldehyde;nickel(2+).
What is the SMILES notation for 2-hydroxybenzaldehyde;nickel(2+)?
The canonical SMILES for 2-hydroxybenzaldehyde;nickel(2+) is O=Cc1ccccc1O.[Ni+2].
What is the InChIKey of 2-hydroxybenzaldehyde;nickel(2+)?
The InChIKey is LWYLEPCHODNCFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.Ni/c8-5-6-3-1-2-4-7(6)9;/h1-5,9H;/q;+2.
What are the key properties of 2-hydroxybenzaldehyde;nickel(2+)?
2-hydroxybenzaldehyde;nickel(2+) has a molecular weight of 180.82 g/mol, XLogP of 1.20, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzaldehyde;nickel(2+) is sourced from PubChem (CID 18320961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).