About copper;ethane-1,2-diamine;2-hydroxybenzaldehyde
copper;ethane-1,2-diamine;2-hydroxybenzaldehyde (PubChem CID 175387187) has the molecular formula C9H14CuN2O2
and a molecular weight of 245.77 g/mol. Its IUPAC name is copper;ethane-1,2-diamine;2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | copper;ethane-1,2-diamine;2-hydroxybenzaldehyde |
| PubChem CID | 175387187 |
| Molecular Formula | C9H14CuN2O2 |
| Molecular Weight | 245.77 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | copper;ethane-1,2-diamine;2-hydroxybenzaldehyde |
| SMILES | NCCN.O=Cc1ccccc1O.[Cu] |
| InChI | InChI=1S/C7H6O2.C2H8N2.Cu/c8-5-6-3-1-2-4-7(6)9;3-1-2-4;/h1-5,9H;1-4H2; |
| InChIKey | XPSPPFJZFRKWRV-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.77 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze copper;ethane-1,2-diamine;2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;ethane-1,2-diamine;2-hydroxybenzaldehyde?
The IUPAC name of copper;ethane-1,2-diamine;2-hydroxybenzaldehyde (CID 175387187) is copper;ethane-1,2-diamine;2-hydroxybenzaldehyde.
What is the SMILES notation for copper;ethane-1,2-diamine;2-hydroxybenzaldehyde?
The canonical SMILES for copper;ethane-1,2-diamine;2-hydroxybenzaldehyde is NCCN.O=Cc1ccccc1O.[Cu].
What is the InChIKey of copper;ethane-1,2-diamine;2-hydroxybenzaldehyde?
The InChIKey is XPSPPFJZFRKWRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C2H8N2.Cu/c8-5-6-3-1-2-4-7(6)9;3-1-2-4;/h1-5,9H;1-4H2;.
What are the key properties of copper;ethane-1,2-diamine;2-hydroxybenzaldehyde?
copper;ethane-1,2-diamine;2-hydroxybenzaldehyde has a molecular weight of 245.77 g/mol, XLogP of 0.11, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;ethane-1,2-diamine;2-hydroxybenzaldehyde is sourced from PubChem (CID 175387187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).