C16H18N2O4 — CID 87454191
2-(1,2-diaminoethoxy)benzaldehyde;2-hydroxybenzaldehyde (PubChem CID 87454191) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-(1,2-diaminoethoxy)benzaldehyde;2-hydroxybenzaldehyde.
| Compound Name | 2-(1,2-diaminoethoxy)benzaldehyde;2-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 87454191 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 2-(1,2-diaminoethoxy)benzaldehyde;2-hydroxybenzaldehyde |
| SMILES | NCC(N)Oc1ccccc1C=O.O=Cc1ccccc1O |
| InChI | InChI=1S/C9H12N2O2.C7H6O2/c10-5-9(11)13-8-4-2-1-3-7(8)6-12;8-5-6-3-1-2-4-7(6)9/h1-4,6,9H,5,10-11H2;1-5,9H |
| InChIKey | LAHNNXKQPWHSHN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|