C13H22N2O2 — CID 158083087
2-hydroxybenzaldehyde;2-methylpentane-1,5-diamine (PubChem CID 158083087) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;2-methylpentane-1,5-diamine.
| Compound Name | 2-hydroxybenzaldehyde;2-methylpentane-1,5-diamine |
|---|---|
| PubChem CID | 158083087 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-hydroxybenzaldehyde;2-methylpentane-1,5-diamine |
| SMILES | CC(CN)CCCN.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H6O2.C6H16N2/c8-5-6-3-1-2-4-7(6)9;1-6(5-8)3-2-4-7/h1-5,9H;6H,2-5,7-8H2,1H3 |
| InChIKey | FNENSUAMHOTZNO-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|