About 2-hydroxybenzaldehyde;2-methoxyaniline
2-hydroxybenzaldehyde;2-methoxyaniline (PubChem CID 174410348) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;2-methoxyaniline.
Molecular Properties
| Compound Name | 2-hydroxybenzaldehyde;2-methoxyaniline |
| PubChem CID | 174410348 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-hydroxybenzaldehyde;2-methoxyaniline |
| SMILES | COc1ccccc1N.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H9NO.C7H6O2/c1-9-7-5-3-2-4-6(7)8;8-5-6-3-1-2-4-7(6)9/h2-5H,8H2,1H3;1-5,9H |
| InChIKey | RHGRPOMDLVOPAK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzaldehyde;2-methoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzaldehyde;2-methoxyaniline?
The IUPAC name of 2-hydroxybenzaldehyde;2-methoxyaniline (CID 174410348) is 2-hydroxybenzaldehyde;2-methoxyaniline.
What is the SMILES notation for 2-hydroxybenzaldehyde;2-methoxyaniline?
The canonical SMILES for 2-hydroxybenzaldehyde;2-methoxyaniline is COc1ccccc1N.O=Cc1ccccc1O.
What is the InChIKey of 2-hydroxybenzaldehyde;2-methoxyaniline?
The InChIKey is RHGRPOMDLVOPAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO.C7H6O2/c1-9-7-5-3-2-4-6(7)8;8-5-6-3-1-2-4-7(6)9/h2-5H,8H2,1H3;1-5,9H.
What are the key properties of 2-hydroxybenzaldehyde;2-methoxyaniline?
2-hydroxybenzaldehyde;2-methoxyaniline has a molecular weight of 245.28 g/mol, XLogP of 2.48, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzaldehyde;2-methoxyaniline is sourced from PubChem (CID 174410348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).