About copper;bis(2-hydroxy-3-methoxybenzaldehyde)
copper;bis(2-hydroxy-3-methoxybenzaldehyde) (PubChem CID 50897387) has the molecular formula C16H16CuO6
and a molecular weight of 367.84 g/mol. Its IUPAC name is copper;bis(2-hydroxy-3-methoxybenzaldehyde).
Molecular Properties
| Compound Name | copper;bis(2-hydroxy-3-methoxybenzaldehyde) |
| PubChem CID | 50897387 |
| Molecular Formula | C16H16CuO6 |
| Molecular Weight | 367.84 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | copper;bis(2-hydroxy-3-methoxybenzaldehyde) |
| SMILES | COc1cccc(C=O)c1O.COc1cccc(C=O)c1O.[Cu] |
| InChI | InChI=1S/2C8H8O3.Cu/c2*1-11-7-4-2-3-6(5-9)8(7)10;/h2*2-5,10H,1H3; |
| InChIKey | MYSDKVBGJDYJAU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze copper;bis(2-hydroxy-3-methoxybenzaldehyde) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(2-hydroxy-3-methoxybenzaldehyde)?
The IUPAC name of copper;bis(2-hydroxy-3-methoxybenzaldehyde) (CID 50897387) is copper;bis(2-hydroxy-3-methoxybenzaldehyde).
What is the SMILES notation for copper;bis(2-hydroxy-3-methoxybenzaldehyde)?
The canonical SMILES for copper;bis(2-hydroxy-3-methoxybenzaldehyde) is COc1cccc(C=O)c1O.COc1cccc(C=O)c1O.[Cu].
What is the InChIKey of copper;bis(2-hydroxy-3-methoxybenzaldehyde)?
The InChIKey is MYSDKVBGJDYJAU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H8O3.Cu/c2*1-11-7-4-2-3-6(5-9)8(7)10;/h2*2-5,10H,1H3;.
What are the key properties of copper;bis(2-hydroxy-3-methoxybenzaldehyde)?
copper;bis(2-hydroxy-3-methoxybenzaldehyde) has a molecular weight of 367.84 g/mol, XLogP of 2.42, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(2-hydroxy-3-methoxybenzaldehyde) is sourced from PubChem (CID 50897387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).