About 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde
1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde (PubChem CID 19867153) has the molecular formula C11H17NO4
and a molecular weight of 227.26 g/mol. Its IUPAC name is 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde |
| PubChem CID | 19867153 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde |
| SMILES | CC(O)CN.COc1cccc(C=O)c1O |
| InChI | InChI=1S/C8H8O3.C3H9NO/c1-11-7-4-2-3-6(5-9)8(7)10;1-3(5)2-4/h2-5,10H,1H3;3,5H,2,4H2,1H3 |
| InChIKey | XKTNMZLNIARMHV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde?
The IUPAC name of 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde (CID 19867153) is 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde.
What is the SMILES notation for 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde?
The canonical SMILES for 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde is CC(O)CN.COc1cccc(C=O)c1O.
What is the InChIKey of 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde?
The InChIKey is XKTNMZLNIARMHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C3H9NO/c1-11-7-4-2-3-6(5-9)8(7)10;1-3(5)2-4/h2-5,10H,1H3;3,5H,2,4H2,1H3.
What are the key properties of 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde?
1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde has a molecular weight of 227.26 g/mol, XLogP of 0.54, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-ol;2-hydroxy-3-methoxybenzaldehyde is sourced from PubChem (CID 19867153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).