About 2-hydroxy-3-methoxybenzaldehyde;methane
2-hydroxy-3-methoxybenzaldehyde;methane (PubChem CID 165075137) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 2-hydroxy-3-methoxybenzaldehyde;methane.
Molecular Properties
| Compound Name | 2-hydroxy-3-methoxybenzaldehyde;methane |
| PubChem CID | 165075137 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 2-hydroxy-3-methoxybenzaldehyde;methane |
| SMILES | C.COc1cccc(C=O)c1O |
| InChI | InChI=1S/C8H8O3.CH4/c1-11-7-4-2-3-6(5-9)8(7)10;/h2-5,10H,1H3;1H4 |
| InChIKey | UEIIVVSERDNQTJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-methoxybenzaldehyde;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-methoxybenzaldehyde;methane?
The IUPAC name of 2-hydroxy-3-methoxybenzaldehyde;methane (CID 165075137) is 2-hydroxy-3-methoxybenzaldehyde;methane.
What is the SMILES notation for 2-hydroxy-3-methoxybenzaldehyde;methane?
The canonical SMILES for 2-hydroxy-3-methoxybenzaldehyde;methane is C.COc1cccc(C=O)c1O.
What is the InChIKey of 2-hydroxy-3-methoxybenzaldehyde;methane?
The InChIKey is UEIIVVSERDNQTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.CH4/c1-11-7-4-2-3-6(5-9)8(7)10;/h2-5,10H,1H3;1H4.
What are the key properties of 2-hydroxy-3-methoxybenzaldehyde;methane?
2-hydroxy-3-methoxybenzaldehyde;methane has a molecular weight of 168.19 g/mol, XLogP of 1.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-methoxybenzaldehyde;methane is sourced from PubChem (CID 165075137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).