About ethene;2-hydroxy-3-methoxybenzaldehyde
ethene;2-hydroxy-3-methoxybenzaldehyde (PubChem CID 175162627) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is ethene;2-hydroxy-3-methoxybenzaldehyde.
Molecular Properties
| Compound Name | ethene;2-hydroxy-3-methoxybenzaldehyde |
| PubChem CID | 175162627 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | ethene;2-hydroxy-3-methoxybenzaldehyde |
| SMILES | C=C.C=C.COc1cccc(C=O)c1O |
| InChI | InChI=1S/C8H8O3.2C2H4/c1-11-7-4-2-3-6(5-9)8(7)10;2*1-2/h2-5,10H,1H3;2*1-2H2 |
| InChIKey | PHDDCDZUJRLPNU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;2-hydroxy-3-methoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;2-hydroxy-3-methoxybenzaldehyde?
The IUPAC name of ethene;2-hydroxy-3-methoxybenzaldehyde (CID 175162627) is ethene;2-hydroxy-3-methoxybenzaldehyde.
What is the SMILES notation for ethene;2-hydroxy-3-methoxybenzaldehyde?
The canonical SMILES for ethene;2-hydroxy-3-methoxybenzaldehyde is C=C.C=C.COc1cccc(C=O)c1O.
What is the InChIKey of ethene;2-hydroxy-3-methoxybenzaldehyde?
The InChIKey is PHDDCDZUJRLPNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.2C2H4/c1-11-7-4-2-3-6(5-9)8(7)10;2*1-2/h2-5,10H,1H3;2*1-2H2.
What are the key properties of ethene;2-hydroxy-3-methoxybenzaldehyde?
ethene;2-hydroxy-3-methoxybenzaldehyde has a molecular weight of 208.26 g/mol, XLogP of 2.82, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;2-hydroxy-3-methoxybenzaldehyde is sourced from PubChem (CID 175162627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).