About 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid
2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid (PubChem CID 175442040) has the molecular formula C14H13NO5
and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid |
| PubChem CID | 175442040 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid |
| SMILES | COc1cccc(C=O)c1O.O=C(O)c1cccnc1 |
| InChI | InChI=1S/C8H8O3.C6H5NO2/c1-11-7-4-2-3-6(5-9)8(7)10;8-6(9)5-2-1-3-7-4-5/h2-5,10H,1H3;1-4H,(H,8,9) |
| InChIKey | XJUYKZYOVPHJRV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid?
The IUPAC name of 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid (CID 175442040) is 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid.
What is the SMILES notation for 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid?
The canonical SMILES for 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid is COc1cccc(C=O)c1O.O=C(O)c1cccnc1.
What is the InChIKey of 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid?
The InChIKey is XJUYKZYOVPHJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3.C6H5NO2/c1-11-7-4-2-3-6(5-9)8(7)10;8-6(9)5-2-1-3-7-4-5/h2-5,10H,1H3;1-4H,(H,8,9).
What are the key properties of 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid?
2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid has a molecular weight of 275.26 g/mol, XLogP of 1.99, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-3-methoxybenzaldehyde;pyridine-3-carboxylic acid is sourced from PubChem (CID 175442040), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).