C14H14N2O5 — CID 139199481
4-hydroxy-3-methoxybenzoic acid;pyridine-3-carboxamide (PubChem CID 139199481) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 4-hydroxy-3-methoxybenzoic acid;pyridine-3-carboxamide.
| Compound Name | 4-hydroxy-3-methoxybenzoic acid;pyridine-3-carboxamide |
|---|---|
| PubChem CID | 139199481 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-hydroxy-3-methoxybenzoic acid;pyridine-3-carboxamide |
| SMILES | COc1cc(C(=O)O)ccc1O.NC(=O)c1cccnc1 |
| InChI | InChI=1S/C8H8O4.C6H6N2O/c1-12-7-4-5(8(10)11)2-3-6(7)9;7-6(9)5-2-1-3-8-4-5/h2-4,9H,1H3,(H,10,11);1-4H,(H2,7,9) |
| InChIKey | YRFOTFCKIWTOBM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 122.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |