About 4-hydroxy-3-methoxybenzoic acid;hydrate
4-hydroxy-3-methoxybenzoic acid;hydrate (PubChem CID 118665847) has the molecular formula C8H10O5
and a molecular weight of 186.16 g/mol. Its IUPAC name is 4-hydroxy-3-methoxybenzoic acid;hydrate.
Molecular Properties
| Compound Name | 4-hydroxy-3-methoxybenzoic acid;hydrate |
| PubChem CID | 118665847 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 4-hydroxy-3-methoxybenzoic acid;hydrate |
| SMILES | COc1cc(C(=O)O)ccc1O.O |
| InChI | InChI=1S/C8H8O4.H2O/c1-12-7-4-5(8(10)11)2-3-6(7)9;/h2-4,9H,1H3,(H,10,11);1H2 |
| InChIKey | ARRCLWBWMNRQCY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-3-methoxybenzoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-methoxybenzoic acid;hydrate?
The IUPAC name of 4-hydroxy-3-methoxybenzoic acid;hydrate (CID 118665847) is 4-hydroxy-3-methoxybenzoic acid;hydrate.
What is the SMILES notation for 4-hydroxy-3-methoxybenzoic acid;hydrate?
The canonical SMILES for 4-hydroxy-3-methoxybenzoic acid;hydrate is COc1cc(C(=O)O)ccc1O.O.
What is the InChIKey of 4-hydroxy-3-methoxybenzoic acid;hydrate?
The InChIKey is ARRCLWBWMNRQCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O4.H2O/c1-12-7-4-5(8(10)11)2-3-6(7)9;/h2-4,9H,1H3,(H,10,11);1H2.
What are the key properties of 4-hydroxy-3-methoxybenzoic acid;hydrate?
4-hydroxy-3-methoxybenzoic acid;hydrate has a molecular weight of 186.16 g/mol, XLogP of 0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-methoxybenzoic acid;hydrate is sourced from PubChem (CID 118665847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).