C22H28O10 — CID 67408860
cyclohexane-1,3-diol;bis(4-hydroxy-3-methoxybenzoic acid) (PubChem CID 67408860) has the molecular formula C22H28O10 and a molecular weight of 452.46 g/mol. Its IUPAC name is cyclohexane-1,3-diol;bis(4-hydroxy-3-methoxybenzoic acid).
| Compound Name | cyclohexane-1,3-diol;bis(4-hydroxy-3-methoxybenzoic acid) |
|---|---|
| PubChem CID | 67408860 |
| Molecular Formula | C22H28O10 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | cyclohexane-1,3-diol;bis(4-hydroxy-3-methoxybenzoic acid) |
| SMILES | COc1cc(C(=O)O)ccc1O.COc1cc(C(=O)O)ccc1O.OC1CCCC(O)C1 |
| InChI | InChI=1S/2C8H8O4.C6H12O2/c2*1-12-7-4-5(8(10)11)2-3-6(7)9;7-5-2-1-3-6(8)4-5/h2*2-4,9H,1H3,(H,10,11);5-8H,1-4H2 |
| InChIKey | HKFXTNDARWOMHQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |