C20H26O9 — CID 162180996
ethanol;ethyl 4-hydroxy-3-methoxybenzoate;4-hydroxy-3-methoxybenzoic acid (PubChem CID 162180996) has the molecular formula C20H26O9 and a molecular weight of 410.42 g/mol. Its IUPAC name is ethanol;ethyl 4-hydroxy-3-methoxybenzoate;4-hydroxy-3-methoxybenzoic acid.
| Compound Name | ethanol;ethyl 4-hydroxy-3-methoxybenzoate;4-hydroxy-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 162180996 |
| Molecular Formula | C20H26O9 |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | ethanol;ethyl 4-hydroxy-3-methoxybenzoate;4-hydroxy-3-methoxybenzoic acid |
| SMILES | CCO.CCOC(=O)c1ccc(O)c(OC)c1.COc1cc(C(=O)O)ccc1O |
| InChI | InChI=1S/C10H12O4.C8H8O4.C2H6O/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2;1-12-7-4-5(8(10)11)2-3-6(7)9;1-2-3/h4-6,11H,3H2,1-2H3;2-4,9H,1H3,(H,10,11);3H,2H2,1H3 |
| InChIKey | ZPABAOGEGHBFAU-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |