C36H48O8 — CID 159377636
3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoic acid;ethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoate (PubChem CID 159377636) has the molecular formula C36H48O8 and a molecular weight of 608.77 g/mol. Its IUPAC name is 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoic acid;ethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoate.
| Compound Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoic acid;ethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoate |
|---|---|
| PubChem CID | 159377636 |
| Molecular Formula | C36H48O8 |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoic acid;ethyl 3-[(2E)-3,7-dimethylocta-2,6-dienoxy]-4-hydroxybenzoate |
| SMILES | CC(C)=CCC/C(C)=C/COc1cc(C(=O)O)ccc1O.CCOC(=O)c1ccc(O)c(OC/C=C(\C)CCC=C(C)C)c1 |
| InChI | InChI=1S/C19H26O4.C17H22O4/c1-5-22-19(21)16-9-10-17(20)18(13-16)23-12-11-15(4)8-6-7-14(2)3;1-12(2)5-4-6-13(3)9-10-21-16-11-14(17(19)20)7-8-15(16)18/h7,9-11,13,20H,5-6,8,12H2,1-4H3;5,7-9,11,18H,4,6,10H2,1-3H3,(H,19,20)/b15-11+;13-9+ |
| InChIKey | LKNCILNQTCCZTN-OMKUQNEDSA-N |
| XLogP | 8.80 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|