C18H24O4 — CID 54425440
4-(3,7-dimethylocta-2,6-dienoxy)-3-methoxybenzoic acid (PubChem CID 54425440) has the molecular formula C18H24O4 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-(3,7-dimethylocta-2,6-dienoxy)-3-methoxybenzoic acid.
| Compound Name | 4-(3,7-dimethylocta-2,6-dienoxy)-3-methoxybenzoic acid |
|---|---|
| PubChem CID | 54425440 |
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 4-(3,7-dimethylocta-2,6-dienoxy)-3-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)ccc1OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C18H24O4/c1-13(2)6-5-7-14(3)10-11-22-16-9-8-15(18(19)20)12-17(16)21-4/h6,8-10,12H,5,7,11H2,1-4H3,(H,19,20) |
| InChIKey | WDTAZUUNSIGDLP-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|