C43H62N2O7 — CID 67564929
3-(3,7-dimethylocta-2,6-dienoxy)-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-methoxybenzamide;3-(3,7-dimethylocta-2,6-dienoxy)-4-methoxybenzoic acid (PubChem CID 67564929) has the molecular formula C43H62N2O7 and a molecular weight of 718.98 g/mol. Its IUPAC name is 3-(3,7-dimethylocta-2,6-dienoxy)-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-methoxybenzamide;3-(3,7-dimethylocta-2,6-dienoxy)-4-methoxybenzoic acid.
| Compound Name | 3-(3,7-dimethylocta-2,6-dienoxy)-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-methoxybenzamide;3-(3,7-dimethylocta-2,6-dienoxy)-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 67564929 |
| Molecular Formula | C43H62N2O7 |
| Molecular Weight | 718.98 g/mol |
| Exact Mass | 718.46 |
| IUPAC Name | 3-(3,7-dimethylocta-2,6-dienoxy)-N-[(1-ethylpyrrolidin-2-yl)methyl]-4-methoxybenzamide;3-(3,7-dimethylocta-2,6-dienoxy)-4-methoxybenzoic acid |
| SMILES | CCN1CCCC1CNC(=O)c1ccc(OC)c(OCC=C(C)CCC=C(C)C)c1.COc1ccc(C(=O)O)cc1OCC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C25H38N2O3.C18H24O4/c1-6-27-15-8-11-22(27)18-26-25(28)21-12-13-23(29-5)24(17-21)30-16-14-20(4)10-7-9-19(2)3;1-13(2)6-5-7-14(3)10-11-22-17-12-15(18(19)20)8-9-16(17)21-4/h9,12-14,17,22H,6-8,10-11,15-16,18H2,1-5H3,(H,26,28);6,8-10,12H,5,7,11H2,1-4H3,(H,19,20) |
| InChIKey | LHXGWHIIDUMUDY-UHFFFAOYSA-N |
| XLogP | 9.45 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.98 |
| LogP ≤ 5 | 9.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|