C32H54N2O — CID 21298047
(2E,6E,10E,14E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide (PubChem CID 21298047) has the molecular formula C32H54N2O and a molecular weight of 482.80 g/mol. Its IUPAC name is (2E,6E,10E,14E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide.
| Compound Name | (2E,6E,10E,14E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide |
|---|---|
| PubChem CID | 21298047 |
| Molecular Formula | C32H54N2O |
| Molecular Weight | 482.80 g/mol |
| Exact Mass | 482.42 |
| IUPAC Name | (2E,6E,10E,14E)-N-[(1-ethylpyrrolidin-2-yl)methyl]-3,7,11,15,19-pentamethylicosa-2,6,10,14,18-pentaenamide |
| SMILES | CCN1CCCC1CNC(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C32H54N2O/c1-8-34-23-13-22-31(34)25-33-32(35)24-30(7)21-12-20-29(6)19-11-18-28(5)17-10-16-27(4)15-9-14-26(2)3/h14,16,18,20,24,31H,8-13,15,17,19,21-23,25H2,1-7H3,(H,33,35)/b27-16+,28-18+,29-20+,30-24+ |
| InChIKey | LARLJABHIIJEOQ-HAJWAVTHSA-N |
| XLogP | 8.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.80 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|