C19H34N2O — CID 54133454
N-[2-(dimethylamino)ethyl]-3,7,11-trimethyldodeca-2,6,10-trienamide (PubChem CID 54133454) has the molecular formula C19H34N2O and a molecular weight of 306.49 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-3,7,11-trimethyldodeca-2,6,10-trienamide.
| Compound Name | N-[2-(dimethylamino)ethyl]-3,7,11-trimethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 54133454 |
| Molecular Formula | C19H34N2O |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-3,7,11-trimethyldodeca-2,6,10-trienamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)NCCN(C)C |
| InChI | InChI=1S/C19H34N2O/c1-16(2)9-7-10-17(3)11-8-12-18(4)15-19(22)20-13-14-21(5)6/h9,11,15H,7-8,10,12-14H2,1-6H3,(H,20,22) |
| InChIKey | NVZPLFJXZIDJGC-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|