C41H69NO — CID 11307844
(2Z,6Z,10Z,14Z,18E,22E)-3,7,11,15,19,23,27-heptamethyl-N,N-di(propan-2-yl)octacosa-2,6,10,14,18,22,26-heptaenamide (PubChem CID 11307844) has the molecular formula C41H69NO and a molecular weight of 592.01 g/mol. Its IUPAC name is (2Z,6Z,10Z,14Z,18E,22E)-3,7,11,15,19,23,27-heptamethyl-N,N-di(propan-2-yl)octacosa-2,6,10,14,18,22,26-heptaenamide.
| Compound Name | (2Z,6Z,10Z,14Z,18E,22E)-3,7,11,15,19,23,27-heptamethyl-N,N-di(propan-2-yl)octacosa-2,6,10,14,18,22,26-heptaenamide |
|---|---|
| PubChem CID | 11307844 |
| Molecular Formula | C41H69NO |
| Molecular Weight | 592.01 g/mol |
| Exact Mass | 591.54 |
| IUPAC Name | (2Z,6Z,10Z,14Z,18E,22E)-3,7,11,15,19,23,27-heptamethyl-N,N-di(propan-2-yl)octacosa-2,6,10,14,18,22,26-heptaenamide |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\CC/C(C)=C\C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C41H69NO/c1-32(2)19-13-20-35(7)21-14-22-36(8)23-15-24-37(9)25-16-26-38(10)27-17-28-39(11)29-18-30-40(12)31-41(43)42(33(3)4)34(5)6/h19,21,23,25,27,29,31,33-34H,13-18,20,22,24,26,28,30H2,1-12H3/b35-21+,36-23+,37-25-,38-27-,39-29-,40-31- |
| InChIKey | CEZZANPVPQDHNL-PNJAIIODSA-N |
| XLogP | 12.96 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.01 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|