C22H37NOS — CID 57031108
3,7,11,15-tetramethyl-N-(1-sulfanylethyl)hexadeca-2,6,10,14-tetraenamide (PubChem CID 57031108) has the molecular formula C22H37NOS and a molecular weight of 363.61 g/mol. Its IUPAC name is 3,7,11,15-tetramethyl-N-(1-sulfanylethyl)hexadeca-2,6,10,14-tetraenamide.
| Compound Name | 3,7,11,15-tetramethyl-N-(1-sulfanylethyl)hexadeca-2,6,10,14-tetraenamide |
|---|---|
| PubChem CID | 57031108 |
| Molecular Formula | C22H37NOS |
| Molecular Weight | 363.61 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 3,7,11,15-tetramethyl-N-(1-sulfanylethyl)hexadeca-2,6,10,14-tetraenamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC(=O)NC(C)S |
| InChI | InChI=1S/C22H37NOS/c1-17(2)10-7-11-18(3)12-8-13-19(4)14-9-15-20(5)16-22(24)23-21(6)25/h10,12,14,16,21,25H,7-9,11,13,15H2,1-6H3,(H,23,24) |
| InChIKey | ALJIMRFNMDUWQN-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.61 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|