C21H36N2O2 — CID 70401956
3,7,11-trimethyl-N-(1-morpholin-4-ylethyl)dodeca-2,6,10-trienamide (PubChem CID 70401956) has the molecular formula C21H36N2O2 and a molecular weight of 348.53 g/mol. Its IUPAC name is 3,7,11-trimethyl-N-(1-morpholin-4-ylethyl)dodeca-2,6,10-trienamide.
| Compound Name | 3,7,11-trimethyl-N-(1-morpholin-4-ylethyl)dodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 70401956 |
| Molecular Formula | C21H36N2O2 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 3,7,11-trimethyl-N-(1-morpholin-4-ylethyl)dodeca-2,6,10-trienamide |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CC(=O)NC(C)N1CCOCC1 |
| InChI | InChI=1S/C21H36N2O2/c1-17(2)8-6-9-18(3)10-7-11-19(4)16-21(24)22-20(5)23-12-14-25-15-13-23/h8,10,16,20H,6-7,9,11-15H2,1-5H3,(H,22,24) |
| InChIKey | MMFRGDZOOKYMOM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|