C15H24N2O — CID 12781848
(3E)-4,8-dimethyl-2-morpholin-4-ylnona-3,7-dienenitrile (PubChem CID 12781848) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is (3E)-4,8-dimethyl-2-morpholin-4-ylnona-3,7-dienenitrile.
| Compound Name | (3E)-4,8-dimethyl-2-morpholin-4-ylnona-3,7-dienenitrile |
|---|---|
| PubChem CID | 12781848 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | (3E)-4,8-dimethyl-2-morpholin-4-ylnona-3,7-dienenitrile |
| SMILES | CC(C)=CCC/C(C)=C/C(C#N)N1CCOCC1 |
| InChI | InChI=1S/C15H24N2O/c1-13(2)5-4-6-14(3)11-15(12-16)17-7-9-18-10-8-17/h5,11,15H,4,6-10H2,1-3H3/b14-11+ |
| InChIKey | ZHEZIYIIGGKRJN-SDNWHVSQSA-N |
| XLogP | 2.90 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|