C15H23NO — CID 11806573
(2S,3E)-2-[(E,1R)-1-hydroxybut-2-enyl]-4,8-dimethylnona-3,7-dienenitrile (PubChem CID 11806573) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is (2S,3E)-2-[(E,1R)-1-hydroxybut-2-enyl]-4,8-dimethylnona-3,7-dienenitrile.
| Compound Name | (2S,3E)-2-[(E,1R)-1-hydroxybut-2-enyl]-4,8-dimethylnona-3,7-dienenitrile |
|---|---|
| PubChem CID | 11806573 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | (2S,3E)-2-[(E,1R)-1-hydroxybut-2-enyl]-4,8-dimethylnona-3,7-dienenitrile |
| SMILES | C/C=C/[C@@H](O)[C@H](C#N)/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C15H23NO/c1-5-7-15(17)14(11-16)10-13(4)9-6-8-12(2)3/h5,7-8,10,14-15,17H,6,9H2,1-4H3/b7-5+,13-10+/t14-,15+/m0/s1 |
| InChIKey | CXWWSGINDCYKLG-ROMJBXORSA-N |
| XLogP | 3.76 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|