C11H18O2 — CID 6433322
(3E)-2-hydroxy-4,8-dimethylnona-3,7-dienal (PubChem CID 6433322) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienal.
| Compound Name | (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienal |
|---|---|
| PubChem CID | 6433322 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (3E)-2-hydroxy-4,8-dimethylnona-3,7-dienal |
| SMILES | CC(C)=CCC/C(C)=C/C(O)C=O |
| InChI | InChI=1S/C11H18O2/c1-9(2)5-4-6-10(3)7-11(13)8-12/h5,7-8,11,13H,4,6H2,1-3H3/b10-7+ |
| InChIKey | DIHFALQHYSMKMB-JXMROGBWSA-N |
| XLogP | 2.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|