C17H28O3 — CID 19705901
(4E,8E)-3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid (PubChem CID 19705901) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is (4E,8E)-3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid.
| Compound Name | (4E,8E)-3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid |
|---|---|
| PubChem CID | 19705901 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (4E,8E)-3-hydroxy-5,9,13-trimethyltetradeca-4,8,12-trienoic acid |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/C(O)CC(=O)O |
| InChI | InChI=1S/C17H28O3/c1-13(2)7-5-8-14(3)9-6-10-15(4)11-16(18)12-17(19)20/h7,9,11,16,18H,5-6,8,10,12H2,1-4H3,(H,19,20)/b14-9+,15-11+ |
| InChIKey | JPXHSQCGXPSEQM-YFVJMOTDSA-N |
| XLogP | 4.24 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|