C31H50O2 — CID 54509422
5,9,13-trimethyl-2-(2,6,10-trimethylundeca-1,5,9-trienyl)tetradeca-4,8,12-trienoic acid (PubChem CID 54509422) has the molecular formula C31H50O2 and a molecular weight of 454.74 g/mol. Its IUPAC name is 5,9,13-trimethyl-2-(2,6,10-trimethylundeca-1,5,9-trienyl)tetradeca-4,8,12-trienoic acid.
| Compound Name | 5,9,13-trimethyl-2-(2,6,10-trimethylundeca-1,5,9-trienyl)tetradeca-4,8,12-trienoic acid |
|---|---|
| PubChem CID | 54509422 |
| Molecular Formula | C31H50O2 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 5,9,13-trimethyl-2-(2,6,10-trimethylundeca-1,5,9-trienyl)tetradeca-4,8,12-trienoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCC(C=C(C)CCC=C(C)CCC=C(C)C)C(=O)O |
| InChI | InChI=1S/C31H50O2/c1-24(2)13-9-15-26(5)17-11-19-28(7)21-22-30(31(32)33)23-29(8)20-12-18-27(6)16-10-14-25(3)4/h13-14,17-18,21,23,30H,9-12,15-16,19-20,22H2,1-8H3,(H,32,33) |
| InChIKey | YIBHGEQZVSDETB-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|