C23H40 — CID 140685405
(6E,10E,14E)-2,6,10,14,17-pentamethyloctadeca-2,6,10,14-tetraene (PubChem CID 140685405) has the molecular formula C23H40 and a molecular weight of 316.57 g/mol. Its IUPAC name is (6E,10E,14E)-2,6,10,14,17-pentamethyloctadeca-2,6,10,14-tetraene.
| Compound Name | (6E,10E,14E)-2,6,10,14,17-pentamethyloctadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 140685405 |
| Molecular Formula | C23H40 |
| Molecular Weight | 316.57 g/mol |
| Exact Mass | 316.31 |
| IUPAC Name | (6E,10E,14E)-2,6,10,14,17-pentamethyloctadeca-2,6,10,14-tetraene |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CC(C)C |
| InChI | InChI=1S/C23H40/c1-19(2)11-8-12-21(5)13-9-14-22(6)15-10-16-23(7)18-17-20(3)4/h11,13,15,18,20H,8-10,12,14,16-17H2,1-7H3/b21-13+,22-15+,23-18+ |
| InChIKey | PLLMLHTXXWBUJP-UZENZRIMSA-N |
| XLogP | 8.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.57 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|