C17H32N2 — CID 90116637
(4E,8E)-5,9,13-trimethyltetradeca-4,8,12-triene-1,2-diamine (PubChem CID 90116637) has the molecular formula C17H32N2 and a molecular weight of 264.46 g/mol. Its IUPAC name is (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-triene-1,2-diamine.
| Compound Name | (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-triene-1,2-diamine |
|---|---|
| PubChem CID | 90116637 |
| Molecular Formula | C17H32N2 |
| Molecular Weight | 264.46 g/mol |
| Exact Mass | 264.26 |
| IUPAC Name | (4E,8E)-5,9,13-trimethyltetradeca-4,8,12-triene-1,2-diamine |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC(N)CN |
| InChI | InChI=1S/C17H32N2/c1-14(2)7-5-8-15(3)9-6-10-16(4)11-12-17(19)13-18/h7,9,11,17H,5-6,8,10,12-13,18-19H2,1-4H3/b15-9+,16-11+ |
| InChIKey | KEILTEXEAMBVEL-XGGJEREUSA-N |
| XLogP | 4.08 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|