C13H25N — CID 170888547
(5E)-6,10-dimethylundeca-5,9-dien-3-amine (PubChem CID 170888547) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is (5E)-6,10-dimethylundeca-5,9-dien-3-amine.
| Compound Name | (5E)-6,10-dimethylundeca-5,9-dien-3-amine |
|---|---|
| PubChem CID | 170888547 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | (5E)-6,10-dimethylundeca-5,9-dien-3-amine |
| SMILES | CCC(N)C/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C13H25N/c1-5-13(14)10-9-12(4)8-6-7-11(2)3/h7,9,13H,5-6,8,10,14H2,1-4H3/b12-9+ |
| InChIKey | AOOUSVFDXXNTKY-FMIVXFBMSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|