C17H30 — CID 123703093
9-ethyl-2,6,10-trimethyldodeca-2,6,10-triene (PubChem CID 123703093) has the molecular formula C17H30 and a molecular weight of 234.43 g/mol. Its IUPAC name is 9-ethyl-2,6,10-trimethyldodeca-2,6,10-triene.
| Compound Name | 9-ethyl-2,6,10-trimethyldodeca-2,6,10-triene |
|---|---|
| PubChem CID | 123703093 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 9-ethyl-2,6,10-trimethyldodeca-2,6,10-triene |
| SMILES | CC=C(C)C(CC)CC=C(C)CCC=C(C)C |
| InChI | InChI=1S/C17H30/c1-7-16(6)17(8-2)13-12-15(5)11-9-10-14(3)4/h7,10,12,17H,8-9,11,13H2,1-6H3 |
| InChIKey | FCADISFTNVVLPU-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|